C19H29NO3 — CID 15856781
(1-cyclohexyl-2-hydroxy-2-phenylethyl) N,N-diethylcarbamate (PubChem CID 15856781) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is (1-cyclohexyl-2-hydroxy-2-phenylethyl) N,N-diethylcarbamate.
| Compound Name | (1-cyclohexyl-2-hydroxy-2-phenylethyl) N,N-diethylcarbamate |
|---|---|
| PubChem CID | 15856781 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | (1-cyclohexyl-2-hydroxy-2-phenylethyl) N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OC(C1CCCCC1)C(O)c1ccccc1 |
| InChI | InChI=1S/C19H29NO3/c1-3-20(4-2)19(22)23-18(16-13-9-6-10-14-16)17(21)15-11-7-5-8-12-15/h5,7-8,11-12,16-18,21H,3-4,6,9-10,13-14H2,1-2H3 |
| InChIKey | VEKIPZNFAFOLJZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |