C23H38OSi — CID 11473834
[(Z,1R)-2-(cyclohexylmethyl)-1-phenylbut-2-enoxy]-triethylsilane (PubChem CID 11473834) has the molecular formula C23H38OSi and a molecular weight of 358.64 g/mol. Its IUPAC name is [(Z,1R)-2-(cyclohexylmethyl)-1-phenylbut-2-enoxy]-triethylsilane.
| Compound Name | [(Z,1R)-2-(cyclohexylmethyl)-1-phenylbut-2-enoxy]-triethylsilane |
|---|---|
| PubChem CID | 11473834 |
| Molecular Formula | C23H38OSi |
| Molecular Weight | 358.64 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | [(Z,1R)-2-(cyclohexylmethyl)-1-phenylbut-2-enoxy]-triethylsilane |
| SMILES | C/C=C(/CC1CCCCC1)[C@@H](O[Si](CC)(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C23H38OSi/c1-5-21(19-20-15-11-9-12-16-20)23(22-17-13-10-14-18-22)24-25(6-2,7-3)8-4/h5,10,13-14,17-18,20,23H,6-9,11-12,15-16,19H2,1-4H3/b21-5-/t23-/m1/s1 |
| InChIKey | AAKCGADDPUZNLC-HXZUVSCCSA-N |
| XLogP | 7.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.64 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|