C16H21NO3 — CID 15408383
methyl (E,2R,3S)-2-acetamido-3-ethyl-5-phenylpent-4-enoate (PubChem CID 15408383) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is methyl (E,2R,3S)-2-acetamido-3-ethyl-5-phenylpent-4-enoate.
| Compound Name | methyl (E,2R,3S)-2-acetamido-3-ethyl-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 15408383 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | methyl (E,2R,3S)-2-acetamido-3-ethyl-5-phenylpent-4-enoate |
| SMILES | CC[C@@H](/C=C/c1ccccc1)[C@@H](NC(C)=O)C(=O)OC |
| InChI | InChI=1S/C16H21NO3/c1-4-14(11-10-13-8-6-5-7-9-13)15(16(19)20-3)17-12(2)18/h5-11,14-15H,4H2,1-3H3,(H,17,18)/b11-10+/t14-,15+/m0/s1 |
| InChIKey | CRVCETPYINFEAC-KZGTWKPJSA-N |
| XLogP | 2.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |