C21H25NO2 — CID 134848197
methyl (2S)-3-phenyl-2-[[(E,3R)-1-phenylpent-1-en-3-yl]amino]propanoate (PubChem CID 134848197) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is methyl (2S)-3-phenyl-2-[[(E,3R)-1-phenylpent-1-en-3-yl]amino]propanoate.
| Compound Name | methyl (2S)-3-phenyl-2-[[(E,3R)-1-phenylpent-1-en-3-yl]amino]propanoate |
|---|---|
| PubChem CID | 134848197 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | methyl (2S)-3-phenyl-2-[[(E,3R)-1-phenylpent-1-en-3-yl]amino]propanoate |
| SMILES | CC[C@H](/C=C/c1ccccc1)N[C@@H](Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C21H25NO2/c1-3-19(15-14-17-10-6-4-7-11-17)22-20(21(23)24-2)16-18-12-8-5-9-13-18/h4-15,19-20,22H,3,16H2,1-2H3/b15-14+/t19-,20+/m1/s1 |
| InChIKey | YMTDOZBROQVEEE-PVGHIGJASA-N |
| XLogP | 3.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |