C18H21NO5 — CID 102186140
prop-2-enyl (E,3R)-2-acetyl-3-(methoxycarbonylamino)-5-phenylpent-4-enoate (PubChem CID 102186140) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is prop-2-enyl (E,3R)-2-acetyl-3-(methoxycarbonylamino)-5-phenylpent-4-enoate.
| Compound Name | prop-2-enyl (E,3R)-2-acetyl-3-(methoxycarbonylamino)-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 102186140 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | prop-2-enyl (E,3R)-2-acetyl-3-(methoxycarbonylamino)-5-phenylpent-4-enoate |
| SMILES | C=CCOC(=O)C(C(C)=O)[C@@H](/C=C/c1ccccc1)NC(=O)OC |
| InChI | InChI=1S/C18H21NO5/c1-4-12-24-17(21)16(13(2)20)15(19-18(22)23-3)11-10-14-8-6-5-7-9-14/h4-11,15-16H,1,12H2,2-3H3,(H,19,22)/b11-10+/t15-,16?/m1/s1 |
| InChIKey | GAFJXCFUYIXITD-BBPVFGCBSA-N |
| XLogP | 2.36 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|