C16H19NO6 — CID 102186142
prop-2-enyl (E,3R)-2-acetyl-5-(furan-2-yl)-3-(methoxycarbonylamino)pent-4-enoate (PubChem CID 102186142) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is prop-2-enyl (E,3R)-2-acetyl-5-(furan-2-yl)-3-(methoxycarbonylamino)pent-4-enoate.
| Compound Name | prop-2-enyl (E,3R)-2-acetyl-5-(furan-2-yl)-3-(methoxycarbonylamino)pent-4-enoate |
|---|---|
| PubChem CID | 102186142 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | prop-2-enyl (E,3R)-2-acetyl-5-(furan-2-yl)-3-(methoxycarbonylamino)pent-4-enoate |
| SMILES | C=CCOC(=O)C(C(C)=O)[C@@H](/C=C/c1ccco1)NC(=O)OC |
| InChI | InChI=1S/C16H19NO6/c1-4-9-23-15(19)14(11(2)18)13(17-16(20)21-3)8-7-12-6-5-10-22-12/h4-8,10,13-14H,1,9H2,2-3H3,(H,17,20)/b8-7+/t13-,14?/m1/s1 |
| InChIKey | KPLDNTMAWRDYTH-QJQWFESSSA-N |
| XLogP | 1.95 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|