C16H25NO3Si — CID 101242323
methyl N-[(E,3S,4S)-1-phenyl-4-trimethylsilyloxypent-1-en-3-yl]carbamate (PubChem CID 101242323) has the molecular formula C16H25NO3Si and a molecular weight of 307.47 g/mol. Its IUPAC name is methyl N-[(E,3S,4S)-1-phenyl-4-trimethylsilyloxypent-1-en-3-yl]carbamate.
| Compound Name | methyl N-[(E,3S,4S)-1-phenyl-4-trimethylsilyloxypent-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 101242323 |
| Molecular Formula | C16H25NO3Si |
| Molecular Weight | 307.47 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | methyl N-[(E,3S,4S)-1-phenyl-4-trimethylsilyloxypent-1-en-3-yl]carbamate |
| SMILES | COC(=O)N[C@@H](/C=C/c1ccccc1)[C@H](C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H25NO3Si/c1-13(20-21(3,4)5)15(17-16(18)19-2)12-11-14-9-7-6-8-10-14/h6-13,15H,1-5H3,(H,17,18)/b12-11+/t13-,15-/m0/s1 |
| InChIKey | FWGJKIKMPUFESP-BJKSPJJASA-N |
| XLogP | 3.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|