(2Z,6E)-3,5-dimethoxy-4-methyl-7-phenylhepta-2,6-dienoic acid

C16H20O4 — CID 22000934

IUPAC(2Z,6E)-3,5-dimethoxy-4-methyl-7-phenylhepta-2,6-dienoic acid
SMILESCO/C(=C\C(=O)O)C(C)C(/C=C/c1ccccc1)OC
InChIInChI=1S/C16H20O4/c1-12(15(20-3)11-16(17)18)14(19-2)10-9-13-7-5-4-6-8-13/h4-12,14H,1-3H3,(H,17,18)/b10-9+,15-11-
InChIKeyLLBUUCBRWPXMJT-RKVFCIRRSA-N
MW276.33 g/mol
LogP2.97
Rot. Bonds7

About (2Z,6E)-3,5-dimethoxy-4-methyl-7-phenylhepta-2,6-dienoic acid

(2Z,6E)-3,5-dimethoxy-4-methyl-7-phenylhepta-2,6-dienoic acid (PubChem CID 22000934) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (2Z,6E)-3,5-dimethoxy-4-methyl-7-phenylhepta-2,6-dienoic acid.

Molecular Properties

Compound Name(2Z,6E)-3,5-dimethoxy-4-methyl-7-phenylhepta-2,6-dienoic acid
PubChem CID22000934
Molecular FormulaC16H20O4
Molecular Weight276.33 g/mol
Exact Mass276.14
IUPAC Name(2Z,6E)-3,5-dimethoxy-4-methyl-7-phenylhepta-2,6-dienoic acid
SMILESCO/C(=C\C(=O)O)C(C)C(/C=C/c1ccccc1)OC
InChIInChI=1S/C16H20O4/c1-12(15(20-3)11-16(17)18)14(19-2)10-9-13-7-5-4-6-8-13/h4-12,14H,1-3H3,(H,17,18)/b10-9+,15-11-
InChIKeyLLBUUCBRWPXMJT-RKVFCIRRSA-N
XLogP2.97
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.33
LogP ≤ 52.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (2Z,6E)-3,5-dimethoxy-4-methyl-7-phenylhepta-2,6-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2Z,6E)-3,5-dimethoxy-4-methyl-7-phenylhepta-2,6-dienoic acid?
The IUPAC name of (2Z,6E)-3,5-dimethoxy-4-methyl-7-phenylhepta-2,6-dienoic acid (CID 22000934) is (2Z,6E)-3,5-dimethoxy-4-methyl-7-phenylhepta-2,6-dienoic acid.
What is the SMILES notation for (2Z,6E)-3,5-dimethoxy-4-methyl-7-phenylhepta-2,6-dienoic acid?
The canonical SMILES for (2Z,6E)-3,5-dimethoxy-4-methyl-7-phenylhepta-2,6-dienoic acid is CO/C(=C\C(=O)O)C(C)C(/C=C/c1ccccc1)OC.
What is the InChIKey of (2Z,6E)-3,5-dimethoxy-4-methyl-7-phenylhepta-2,6-dienoic acid?
The InChIKey is LLBUUCBRWPXMJT-RKVFCIRRSA-N. The full InChI is InChI=1S/C16H20O4/c1-12(15(20-3)11-16(17)18)14(19-2)10-9-13-7-5-4-6-8-13/h4-12,14H,1-3H3,(H,17,18)/b10-9+,15-11-.
What are the key properties of (2Z,6E)-3,5-dimethoxy-4-methyl-7-phenylhepta-2,6-dienoic acid?
(2Z,6E)-3,5-dimethoxy-4-methyl-7-phenylhepta-2,6-dienoic acid has a molecular weight of 276.33 g/mol, XLogP of 2.97, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,6E)-3,5-dimethoxy-4-methyl-7-phenylhepta-2,6-dienoic acid is sourced from PubChem (CID 22000934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).