C17H24O2 — CID 101250829
[(1E,3S,4R,5R)-3,5-dimethoxy-4,6-dimethylhepta-1,6-dienyl]benzene (PubChem CID 101250829) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is [(1E,3S,4R,5R)-3,5-dimethoxy-4,6-dimethylhepta-1,6-dienyl]benzene.
| Compound Name | [(1E,3S,4R,5R)-3,5-dimethoxy-4,6-dimethylhepta-1,6-dienyl]benzene |
|---|---|
| PubChem CID | 101250829 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | [(1E,3S,4R,5R)-3,5-dimethoxy-4,6-dimethylhepta-1,6-dienyl]benzene |
| SMILES | C=C(C)[C@H](OC)[C@H](C)[C@H](/C=C/c1ccccc1)OC |
| InChI | InChI=1S/C17H24O2/c1-13(2)17(19-5)14(3)16(18-4)12-11-15-9-7-6-8-10-15/h6-12,14,16-17H,1H2,2-5H3/b12-11+/t14-,16+,17+/m1/s1 |
| InChIKey | BNMSVPOTCHGMMY-HYJDGZGDSA-N |
| XLogP | 3.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|