C16H21NO3 — CID 70268630
(2E,4S,5R,6E)-3,5-dimethoxy-4-methyl-7-phenylhepta-2,6-dienamide (PubChem CID 70268630) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (2E,4S,5R,6E)-3,5-dimethoxy-4-methyl-7-phenylhepta-2,6-dienamide.
| Compound Name | (2E,4S,5R,6E)-3,5-dimethoxy-4-methyl-7-phenylhepta-2,6-dienamide |
|---|---|
| PubChem CID | 70268630 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (2E,4S,5R,6E)-3,5-dimethoxy-4-methyl-7-phenylhepta-2,6-dienamide |
| SMILES | CO/C(=C/C(N)=O)[C@@H](C)[C@@H](/C=C/c1ccccc1)OC |
| InChI | InChI=1S/C16H21NO3/c1-12(15(20-3)11-16(17)18)14(19-2)10-9-13-7-5-4-6-8-13/h4-12,14H,1-3H3,(H2,17,18)/b10-9+,15-11+/t12-,14+/m0/s1 |
| InChIKey | MVPAIMSSDSMCDB-RRVTXDOESA-N |
| XLogP | 2.37 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|