C28H40OSi3 — CID 10766972
1,4,4-tris[dimethyl(phenyl)silyl]butan-1-ol (PubChem CID 10766972) has the molecular formula C28H40OSi3 and a molecular weight of 476.89 g/mol. Its IUPAC name is 1,4,4-tris[dimethyl(phenyl)silyl]butan-1-ol.
| Compound Name | 1,4,4-tris[dimethyl(phenyl)silyl]butan-1-ol |
|---|---|
| PubChem CID | 10766972 |
| Molecular Formula | C28H40OSi3 |
| Molecular Weight | 476.89 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 1,4,4-tris[dimethyl(phenyl)silyl]butan-1-ol |
| SMILES | C[Si](C)(c1ccccc1)C(O)CCC([Si](C)(C)c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C28H40OSi3/c1-30(2,24-16-10-7-11-17-24)27(29)22-23-28(31(3,4)25-18-12-8-13-19-25)32(5,6)26-20-14-9-15-21-26/h7-21,27-29H,22-23H2,1-6H3 |
| InChIKey | BPJQJVWVKSWPSC-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.89 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|