C16H26OSi — CID 22967163
1-(but-3-enyl-methyl-phenylsilyl)-3-methylbutan-1-ol (PubChem CID 22967163) has the molecular formula C16H26OSi and a molecular weight of 262.47 g/mol. Its IUPAC name is 1-(but-3-enyl-methyl-phenylsilyl)-3-methylbutan-1-ol.
| Compound Name | 1-(but-3-enyl-methyl-phenylsilyl)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 22967163 |
| Molecular Formula | C16H26OSi |
| Molecular Weight | 262.47 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 1-(but-3-enyl-methyl-phenylsilyl)-3-methylbutan-1-ol |
| SMILES | C=CCC[Si](C)(c1ccccc1)C(O)CC(C)C |
| InChI | InChI=1S/C16H26OSi/c1-5-6-12-18(4,16(17)13-14(2)3)15-10-8-7-9-11-15/h5,7-11,14,16-17H,1,6,12-13H2,2-4H3 |
| InChIKey | LLXXVUKDUKTMIK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|