C22H29NO3Si — CID 22967170
3-[(1-benzamido-3-methylbutyl)-methyl-phenylsilyl]propanoic acid (PubChem CID 22967170) has the molecular formula C22H29NO3Si and a molecular weight of 383.56 g/mol. Its IUPAC name is 3-[(1-benzamido-3-methylbutyl)-methyl-phenylsilyl]propanoic acid.
| Compound Name | 3-[(1-benzamido-3-methylbutyl)-methyl-phenylsilyl]propanoic acid |
|---|---|
| PubChem CID | 22967170 |
| Molecular Formula | C22H29NO3Si |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 3-[(1-benzamido-3-methylbutyl)-methyl-phenylsilyl]propanoic acid |
| SMILES | CC(C)CC(NC(=O)c1ccccc1)[Si](C)(CCC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C22H29NO3Si/c1-17(2)16-20(23-22(26)18-10-6-4-7-11-18)27(3,15-14-21(24)25)19-12-8-5-9-13-19/h4-13,17,20H,14-16H2,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | MXMQOPUXJVTKJU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|