C28H33NO3Si — CID 15349853
3-[(1-benzamido-3-methylbutyl)-diphenylsilyl]-2-methylpropanoic acid (PubChem CID 15349853) has the molecular formula C28H33NO3Si and a molecular weight of 459.66 g/mol. Its IUPAC name is 3-[(1-benzamido-3-methylbutyl)-diphenylsilyl]-2-methylpropanoic acid.
| Compound Name | 3-[(1-benzamido-3-methylbutyl)-diphenylsilyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 15349853 |
| Molecular Formula | C28H33NO3Si |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 3-[(1-benzamido-3-methylbutyl)-diphenylsilyl]-2-methylpropanoic acid |
| SMILES | CC(C)CC(NC(=O)c1ccccc1)[Si](CC(C)C(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33NO3Si/c1-21(2)19-26(29-27(30)23-13-7-4-8-14-23)33(20-22(3)28(31)32,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-18,21-22,26H,19-20H2,1-3H3,(H,29,30)(H,31,32) |
| InChIKey | BKHWDYQDJBXFMY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|