C13H19NO — CID 176730302
N-[(2R)-1,1,1-trideuterio-4-methylpentan-2-yl]benzamide (PubChem CID 176730302) has the molecular formula C13H19NO and a molecular weight of 208.32 g/mol. Its IUPAC name is N-[(2R)-1,1,1-trideuterio-4-methylpentan-2-yl]benzamide.
| Compound Name | N-[(2R)-1,1,1-trideuterio-4-methylpentan-2-yl]benzamide |
|---|---|
| PubChem CID | 176730302 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 208.32 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N-[(2R)-1,1,1-trideuterio-4-methylpentan-2-yl]benzamide |
| SMILES | [2H]C([2H])([2H])[C@H](CC(C)C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H19NO/c1-10(2)9-11(3)14-13(15)12-7-5-4-6-8-12/h4-8,10-11H,9H2,1-3H3,(H,14,15)/t11-/m1/s1/i3D3 |
| InChIKey | VFMMJMOYGNCONK-LMUHODJSSA-N |
| XLogP | 2.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |