C37H48N2O4Si — CID 15349855
tert-butyl (2S)-1-[3-[(1-benzamido-3-methylbutyl)-diphenylsilyl]-2-methylpropanoyl]pyrrolidine-2-carboxylate (PubChem CID 15349855) has the molecular formula C37H48N2O4Si and a molecular weight of 612.89 g/mol. Its IUPAC name is tert-butyl (2S)-1-[3-[(1-benzamido-3-methylbutyl)-diphenylsilyl]-2-methylpropanoyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[3-[(1-benzamido-3-methylbutyl)-diphenylsilyl]-2-methylpropanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 15349855 |
| Molecular Formula | C37H48N2O4Si |
| Molecular Weight | 612.89 g/mol |
| Exact Mass | 612.34 |
| IUPAC Name | tert-butyl (2S)-1-[3-[(1-benzamido-3-methylbutyl)-diphenylsilyl]-2-methylpropanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)CC(NC(=O)c1ccccc1)[Si](CC(C)C(=O)N1CCC[C@H]1C(=O)OC(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H48N2O4Si/c1-27(2)25-33(38-34(40)29-17-10-7-11-18-29)44(30-19-12-8-13-20-30,31-21-14-9-15-22-31)26-28(3)35(41)39-24-16-23-32(39)36(42)43-37(4,5)6/h7-15,17-22,27-28,32-33H,16,23-26H2,1-6H3,(H,38,40)/t28?,32-,33?/m0/s1 |
| InChIKey | YIDDAYOMTSJHGY-DDWOKDRJSA-N |
| XLogP | 5.60 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.89 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|