C32H46N2O4Si — CID 101185925
tert-butyl (2S)-1-[3-[(1-benzamido-3-methylbutyl)-methyl-phenylsilyl]-2-methylpropanoyl]pyrrolidine-2-carboxylate (PubChem CID 101185925) has the molecular formula C32H46N2O4Si and a molecular weight of 550.82 g/mol. Its IUPAC name is tert-butyl (2S)-1-[3-[(1-benzamido-3-methylbutyl)-methyl-phenylsilyl]-2-methylpropanoyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[3-[(1-benzamido-3-methylbutyl)-methyl-phenylsilyl]-2-methylpropanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 101185925 |
| Molecular Formula | C32H46N2O4Si |
| Molecular Weight | 550.82 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | tert-butyl (2S)-1-[3-[(1-benzamido-3-methylbutyl)-methyl-phenylsilyl]-2-methylpropanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)CC(NC(=O)c1ccccc1)[Si](C)(CC(C)C(=O)N1CCC[C@H]1C(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C32H46N2O4Si/c1-23(2)21-28(33-29(35)25-15-10-8-11-16-25)39(7,26-17-12-9-13-18-26)22-24(3)30(36)34-20-14-19-27(34)31(37)38-32(4,5)6/h8-13,15-18,23-24,27-28H,14,19-22H2,1-7H3,(H,33,35)/t24?,27-,28?,39?/m0/s1 |
| InChIKey | VHTAUWDMBDLIHR-IWIHORKLSA-N |
| XLogP | 5.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.82 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|