C15H27NO3 — CID 81002524
tert-butyl (2R)-1-(2-methylpentanoyl)pyrrolidine-2-carboxylate (PubChem CID 81002524) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is tert-butyl (2R)-1-(2-methylpentanoyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R)-1-(2-methylpentanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 81002524 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | tert-butyl (2R)-1-(2-methylpentanoyl)pyrrolidine-2-carboxylate |
| SMILES | CCCC(C)C(=O)N1CCC[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27NO3/c1-6-8-11(2)13(17)16-10-7-9-12(16)14(18)19-15(3,4)5/h11-12H,6-10H2,1-5H3/t11?,12-/m1/s1 |
| InChIKey | DVOUDCYWEGGGPS-PIJUOVFKSA-N |
| XLogP | 2.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |