C20H32Cl3NO5 — CID 10766846
tert-butyl (2S)-1-[(2R)-2-[2-oxo-2-(2,2,2-trichloroethoxy)ethyl]heptanoyl]pyrrolidine-2-carboxylate (PubChem CID 10766846) has the molecular formula C20H32Cl3NO5 and a molecular weight of 472.84 g/mol. Its IUPAC name is tert-butyl (2S)-1-[(2R)-2-[2-oxo-2-(2,2,2-trichloroethoxy)ethyl]heptanoyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[(2R)-2-[2-oxo-2-(2,2,2-trichloroethoxy)ethyl]heptanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 10766846 |
| Molecular Formula | C20H32Cl3NO5 |
| Molecular Weight | 472.84 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | tert-butyl (2S)-1-[(2R)-2-[2-oxo-2-(2,2,2-trichloroethoxy)ethyl]heptanoyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCCC(CC(=O)OCC(Cl)(Cl)Cl)C(=O)N1CCC[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H32Cl3NO5/c1-5-6-7-9-14(12-16(25)28-13-20(21,22)23)17(26)24-11-8-10-15(24)18(27)29-19(2,3)4/h14-15H,5-13H2,1-4H3/t14?,15-/m0/s1 |
| InChIKey | NUKGFHQQRZSEQO-LOACHALJSA-N |
| XLogP | 4.82 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.84 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|