C18H32N2O5 — CID 23520236
tert-butyl (2S)-1-[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]hexanoyl]piperidine-2-carboxylate (PubChem CID 23520236) has the molecular formula C18H32N2O5 and a molecular weight of 356.46 g/mol. Its IUPAC name is tert-butyl (2S)-1-[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]hexanoyl]piperidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]hexanoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 23520236 |
| Molecular Formula | C18H32N2O5 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | tert-butyl (2S)-1-[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]hexanoyl]piperidine-2-carboxylate |
| SMILES | CCCC[C@H](CC(=O)NO)C(=O)N1CCCC[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H32N2O5/c1-5-6-9-13(12-15(21)19-24)16(22)20-11-8-7-10-14(20)17(23)25-18(2,3)4/h13-14,24H,5-12H2,1-4H3,(H,19,21)/t13-,14+/m1/s1 |
| InChIKey | QTELMBMDOCVXHM-KGLIPLIRSA-N |
| XLogP | 2.41 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|