C12H22N2O3 — CID 23520253
(3R)-N-hydroxy-3-(pyrrolidine-1-carbonyl)heptanamide (PubChem CID 23520253) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is (3R)-N-hydroxy-3-(pyrrolidine-1-carbonyl)heptanamide.
| Compound Name | (3R)-N-hydroxy-3-(pyrrolidine-1-carbonyl)heptanamide |
|---|---|
| PubChem CID | 23520253 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | (3R)-N-hydroxy-3-(pyrrolidine-1-carbonyl)heptanamide |
| SMILES | CCCC[C@H](CC(=O)NO)C(=O)N1CCCC1 |
| InChI | InChI=1S/C12H22N2O3/c1-2-3-6-10(9-11(15)13-17)12(16)14-7-4-5-8-14/h10,17H,2-9H2,1H3,(H,13,15)/t10-/m1/s1 |
| InChIKey | YMMVLDYPKBFSKQ-SNVBAGLBSA-N |
| XLogP | 1.31 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|