C15H29BrN2O — CID 80665419
1-[4-(2-bromoethyl)-1,4-diazepan-1-yl]-2-ethylhexan-1-one (PubChem CID 80665419) has the molecular formula C15H29BrN2O and a molecular weight of 333.31 g/mol. Its IUPAC name is 1-[4-(2-bromoethyl)-1,4-diazepan-1-yl]-2-ethylhexan-1-one.
| Compound Name | 1-[4-(2-bromoethyl)-1,4-diazepan-1-yl]-2-ethylhexan-1-one |
|---|---|
| PubChem CID | 80665419 |
| Molecular Formula | C15H29BrN2O |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1-[4-(2-bromoethyl)-1,4-diazepan-1-yl]-2-ethylhexan-1-one |
| SMILES | CCCCC(CC)C(=O)N1CCCN(CCBr)CC1 |
| InChI | InChI=1S/C15H29BrN2O/c1-3-5-7-14(4-2)15(19)18-10-6-9-17(11-8-16)12-13-18/h14H,3-13H2,1-2H3 |
| InChIKey | AOZZDNRKOZPJGQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|