C18H28N4O4S — CID 23520196
(2S)-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1-[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]hexanoyl]pyrrolidine-2-carboxamide (PubChem CID 23520196) has the molecular formula C18H28N4O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is (2S)-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1-[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]hexanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1-[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]hexanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23520196 |
| Molecular Formula | C18H28N4O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (2S)-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1-[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]hexanoyl]pyrrolidine-2-carboxamide |
| SMILES | CCCC[C@H](CC(=O)NO)C(=O)N1CCC[C@H]1C(=O)Nc1nc(C)c(C)s1 |
| InChI | InChI=1S/C18H28N4O4S/c1-4-5-7-13(10-15(23)21-26)17(25)22-9-6-8-14(22)16(24)20-18-19-11(2)12(3)27-18/h13-14,26H,4-10H2,1-3H3,(H,21,23)(H,19,20,24)/t13-,14+/m1/s1 |
| InChIKey | VEKCWLLKSKQLMA-KGLIPLIRSA-N |
| XLogP | 2.39 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|