C18H33N3O5 — CID 23520183
(2S)-1-[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-(2-methylbutan-2-yl)pyrrolidine-2-carboxamide (PubChem CID 23520183) has the molecular formula C18H33N3O5 and a molecular weight of 371.48 g/mol. Its IUPAC name is (2S)-1-[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-(2-methylbutan-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-(2-methylbutan-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23520183 |
| Molecular Formula | C18H33N3O5 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | (2S)-1-[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-(2-methylbutan-2-yl)pyrrolidine-2-carboxamide |
| SMILES | CCCC[C@@H](C(=O)N1CCC[C@H]1C(=O)NC(C)(C)CC)[C@H](O)C(=O)NO |
| InChI | InChI=1S/C18H33N3O5/c1-5-7-9-12(14(22)16(24)20-26)17(25)21-11-8-10-13(21)15(23)19-18(3,4)6-2/h12-14,22,26H,5-11H2,1-4H3,(H,19,23)(H,20,24)/t12-,13+,14+/m1/s1 |
| InChIKey | QWRBYXRWVMZOIS-RDBSUJKOSA-N |
| XLogP | 0.95 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|