C18H27FN4O4S — CID 23520271
(2S)-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1-[(2S)-2-[(1R)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]pyrrolidine-2-carboxamide (PubChem CID 23520271) has the molecular formula C18H27FN4O4S and a molecular weight of 414.50 g/mol. Its IUPAC name is (2S)-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1-[(2S)-2-[(1R)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1-[(2S)-2-[(1R)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23520271 |
| Molecular Formula | C18H27FN4O4S |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (2S)-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1-[(2S)-2-[(1R)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]pyrrolidine-2-carboxamide |
| SMILES | CCCC[C@@H](C(=O)N1CCC[C@H]1C(=O)Nc1nc(C)c(C)s1)[C@@H](F)C(=O)NO |
| InChI | InChI=1S/C18H27FN4O4S/c1-4-5-7-12(14(19)16(25)22-27)17(26)23-9-6-8-13(23)15(24)21-18-20-10(2)11(3)28-18/h12-14,27H,4-9H2,1-3H3,(H,22,25)(H,20,21,24)/t12-,13+,14-/m1/s1 |
| InChIKey | YBVPXLYUVNYFKN-HZSPNIEDSA-N |
| XLogP | 2.34 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|