C21H28FN5O4S — CID 22666893
1-[2-[1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-(5-phenyl-3H-thiadiazol-2-yl)pyrrolidine-2-carboxamide (PubChem CID 22666893) has the molecular formula C21H28FN5O4S and a molecular weight of 465.55 g/mol. Its IUPAC name is 1-[2-[1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-(5-phenyl-3H-thiadiazol-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[2-[1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-(5-phenyl-3H-thiadiazol-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 22666893 |
| Molecular Formula | C21H28FN5O4S |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 1-[2-[1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-(5-phenyl-3H-thiadiazol-2-yl)pyrrolidine-2-carboxamide |
| SMILES | CCCCC(C(=O)N1CCCC1C(=O)NN1NC=C(c2ccccc2)S1)C(F)C(=O)NO |
| InChI | InChI=1S/C21H28FN5O4S/c1-2-3-10-15(18(22)20(29)25-31)21(30)26-12-7-11-16(26)19(28)24-27-23-13-17(32-27)14-8-5-4-6-9-14/h4-6,8-9,13,15-16,18,23,31H,2-3,7,10-12H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | IINGBIUFPHNZEZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|