C15H22FN3O4 — CID 23591386
2-fluoro-N-hydroxy-3-[2-(1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]heptanamide (PubChem CID 23591386) has the molecular formula C15H22FN3O4 and a molecular weight of 327.36 g/mol. Its IUPAC name is 2-fluoro-N-hydroxy-3-[2-(1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]heptanamide.
| Compound Name | 2-fluoro-N-hydroxy-3-[2-(1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]heptanamide |
|---|---|
| PubChem CID | 23591386 |
| Molecular Formula | C15H22FN3O4 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 2-fluoro-N-hydroxy-3-[2-(1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]heptanamide |
| SMILES | CCCCC(C(=O)N1CCCC1c1ncco1)C(F)C(=O)NO |
| InChI | InChI=1S/C15H22FN3O4/c1-2-3-5-10(12(16)13(20)18-22)15(21)19-8-4-6-11(19)14-17-7-9-23-14/h7,9-12,22H,2-6,8H2,1H3,(H,18,20) |
| InChIKey | JOIFWAGGGMYBAH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|