C14H24FN3O4 — CID 23520292
(2S)-1-[(2S)-2-[(1R)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-methylpyrrolidine-2-carboxamide (PubChem CID 23520292) has the molecular formula C14H24FN3O4 and a molecular weight of 317.36 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[(1R)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-methylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-[(1R)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23520292 |
| Molecular Formula | C14H24FN3O4 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (2S)-1-[(2S)-2-[(1R)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-methylpyrrolidine-2-carboxamide |
| SMILES | CCCC[C@@H](C(=O)N1CCC[C@H]1C(=O)NC)[C@@H](F)C(=O)NO |
| InChI | InChI=1S/C14H24FN3O4/c1-3-4-6-9(11(15)13(20)17-22)14(21)18-8-5-7-10(18)12(19)16-2/h9-11,22H,3-8H2,1-2H3,(H,16,19)(H,17,20)/t9-,10+,11-/m1/s1 |
| InChIKey | PWFIMOOUBGVUJW-OUAUKWLOSA-N |
| XLogP | 0.37 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|