C22H30FN3O4 — CID 23520290
(2S)-N-(2,3-dihydro-1H-inden-5-yl)-1-[(2S)-2-[(1R)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]pyrrolidine-2-carboxamide (PubChem CID 23520290) has the molecular formula C22H30FN3O4 and a molecular weight of 419.50 g/mol. Its IUPAC name is (2S)-N-(2,3-dihydro-1H-inden-5-yl)-1-[(2S)-2-[(1R)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(2,3-dihydro-1H-inden-5-yl)-1-[(2S)-2-[(1R)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23520290 |
| Molecular Formula | C22H30FN3O4 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | (2S)-N-(2,3-dihydro-1H-inden-5-yl)-1-[(2S)-2-[(1R)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]pyrrolidine-2-carboxamide |
| SMILES | CCCC[C@@H](C(=O)N1CCC[C@H]1C(=O)Nc1ccc2c(c1)CCC2)[C@@H](F)C(=O)NO |
| InChI | InChI=1S/C22H30FN3O4/c1-2-3-8-17(19(23)21(28)25-30)22(29)26-12-5-9-18(26)20(27)24-16-11-10-14-6-4-7-15(14)13-16/h10-11,13,17-19,30H,2-9,12H2,1H3,(H,24,27)(H,25,28)/t17-,18+,19-/m1/s1 |
| InChIKey | VZRMNYKQSUMJGR-CEXWTWQISA-N |
| XLogP | 2.75 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|