C18H32FN3O4 — CID 23520297
(2S)-1-[(2S)-2-[(1S)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-pentylpyrrolidine-2-carboxamide (PubChem CID 23520297) has the molecular formula C18H32FN3O4 and a molecular weight of 373.47 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[(1S)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-pentylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-[(1S)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-pentylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23520297 |
| Molecular Formula | C18H32FN3O4 |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | (2S)-1-[(2S)-2-[(1S)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-pentylpyrrolidine-2-carboxamide |
| SMILES | CCCCCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCC)[C@H](F)C(=O)NO |
| InChI | InChI=1S/C18H32FN3O4/c1-3-5-7-11-20-16(23)14-10-8-12-22(14)18(25)13(9-6-4-2)15(19)17(24)21-26/h13-15,26H,3-12H2,1-2H3,(H,20,23)(H,21,24)/t13-,14+,15+/m1/s1 |
| InChIKey | JMMMLKBMXVFAAW-ILXRZTDVSA-N |
| XLogP | 1.93 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|