C22H27FN4O4 — CID 59908496
1-[(2S)-2-[(1R)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-quinolin-3-ylpyrrolidine-2-carboxamide (PubChem CID 59908496) has the molecular formula C22H27FN4O4 and a molecular weight of 430.48 g/mol. Its IUPAC name is 1-[(2S)-2-[(1R)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-quinolin-3-ylpyrrolidine-2-carboxamide.
| Compound Name | 1-[(2S)-2-[(1R)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-quinolin-3-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59908496 |
| Molecular Formula | C22H27FN4O4 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 1-[(2S)-2-[(1R)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-quinolin-3-ylpyrrolidine-2-carboxamide |
| SMILES | CCCC[C@@H](C(=O)N1CCCC1C(=O)Nc1cnc2ccccc2c1)[C@@H](F)C(=O)NO |
| InChI | InChI=1S/C22H27FN4O4/c1-2-3-8-16(19(23)21(29)26-31)22(30)27-11-6-10-18(27)20(28)25-15-12-14-7-4-5-9-17(14)24-13-15/h4-5,7,9,12-13,16,18-19,31H,2-3,6,8,10-11H2,1H3,(H,25,28)(H,26,29)/t16-,18?,19-/m1/s1 |
| InChIKey | PMGGIMGJERVSMN-LPZUGFHBSA-N |
| XLogP | 2.81 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|