C16H26FN3O4 — CID 22666890
1-[2-[1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-prop-2-enylpyrrolidine-2-carboxamide (PubChem CID 22666890) has the molecular formula C16H26FN3O4 and a molecular weight of 343.40 g/mol. Its IUPAC name is 1-[2-[1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-prop-2-enylpyrrolidine-2-carboxamide.
| Compound Name | 1-[2-[1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-prop-2-enylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 22666890 |
| Molecular Formula | C16H26FN3O4 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 1-[2-[1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-prop-2-enylpyrrolidine-2-carboxamide |
| SMILES | C=CCNC(=O)C1CCCN1C(=O)C(CCCC)C(F)C(=O)NO |
| InChI | InChI=1S/C16H26FN3O4/c1-3-5-7-11(13(17)15(22)19-24)16(23)20-10-6-8-12(20)14(21)18-9-4-2/h4,11-13,24H,2-3,5-10H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | CNLGMMNWULFALL-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|