C25H30FN3O5 — CID 59908571
1-[(2S)-2-[(1S)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-(3-phenoxyphenyl)pyrrolidine-2-carboxamide (PubChem CID 59908571) has the molecular formula C25H30FN3O5 and a molecular weight of 471.53 g/mol. Its IUPAC name is 1-[(2S)-2-[(1S)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-(3-phenoxyphenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[(2S)-2-[(1S)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-(3-phenoxyphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59908571 |
| Molecular Formula | C25H30FN3O5 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 1-[(2S)-2-[(1S)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-(3-phenoxyphenyl)pyrrolidine-2-carboxamide |
| SMILES | CCCC[C@@H](C(=O)N1CCCC1C(=O)Nc1cccc(Oc2ccccc2)c1)[C@H](F)C(=O)NO |
| InChI | InChI=1S/C25H30FN3O5/c1-2-3-13-20(22(26)24(31)28-33)25(32)29-15-8-14-21(29)23(30)27-17-9-7-12-19(16-17)34-18-10-5-4-6-11-18/h4-7,9-12,16,20-22,33H,2-3,8,13-15H2,1H3,(H,27,30)(H,28,31)/t20-,21?,22+/m1/s1 |
| InChIKey | JULIEJDXYKESNY-QFMSAKRMSA-N |
| XLogP | 4.06 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|