C23H34FN3O4 — CID 22666996
N-(4-tert-butylphenyl)-1-[2-[1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]pyrrolidine-2-carboxamide (PubChem CID 22666996) has the molecular formula C23H34FN3O4 and a molecular weight of 435.54 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-1-[2-[1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-1-[2-[1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 22666996 |
| Molecular Formula | C23H34FN3O4 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | N-(4-tert-butylphenyl)-1-[2-[1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]pyrrolidine-2-carboxamide |
| SMILES | CCCCC(C(=O)N1CCCC1C(=O)Nc1ccc(C(C)(C)C)cc1)C(F)C(=O)NO |
| InChI | InChI=1S/C23H34FN3O4/c1-5-6-8-17(19(24)21(29)26-31)22(30)27-14-7-9-18(27)20(28)25-16-12-10-15(11-13-16)23(2,3)4/h10-13,17-19,31H,5-9,14H2,1-4H3,(H,25,28)(H,26,29) |
| InChIKey | QPPFIPUJEZYCSD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|