C22H32FN3O6 — CID 59908493
N-[(2,4-dimethoxyphenyl)methyl]-1-[(2S)-2-[(1S)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]pyrrolidine-2-carboxamide (PubChem CID 59908493) has the molecular formula C22H32FN3O6 and a molecular weight of 453.51 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-1-[(2S)-2-[(1S)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-1-[(2S)-2-[(1S)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59908493 |
| Molecular Formula | C22H32FN3O6 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-1-[(2S)-2-[(1S)-1-fluoro-2-(hydroxyamino)-2-oxoethyl]hexanoyl]pyrrolidine-2-carboxamide |
| SMILES | CCCC[C@@H](C(=O)N1CCCC1C(=O)NCc1ccc(OC)cc1OC)[C@H](F)C(=O)NO |
| InChI | InChI=1S/C22H32FN3O6/c1-4-5-7-16(19(23)21(28)25-30)22(29)26-11-6-8-17(26)20(27)24-13-14-9-10-15(31-2)12-18(14)32-3/h9-10,12,16-17,19,30H,4-8,11,13H2,1-3H3,(H,24,27)(H,25,28)/t16-,17?,19+/m1/s1 |
| InChIKey | UOIBAYPPDCHLMV-HHBDYARMSA-N |
| XLogP | 1.96 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|