C17H29N3O6 — CID 23520223
(2S,3R)-N,2-dihydroxy-3-[(2S)-2-(morpholine-4-carbonyl)pyrrolidine-1-carbonyl]heptanamide (PubChem CID 23520223) has the molecular formula C17H29N3O6 and a molecular weight of 371.43 g/mol. Its IUPAC name is (2S,3R)-N,2-dihydroxy-3-[(2S)-2-(morpholine-4-carbonyl)pyrrolidine-1-carbonyl]heptanamide.
| Compound Name | (2S,3R)-N,2-dihydroxy-3-[(2S)-2-(morpholine-4-carbonyl)pyrrolidine-1-carbonyl]heptanamide |
|---|---|
| PubChem CID | 23520223 |
| Molecular Formula | C17H29N3O6 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | (2S,3R)-N,2-dihydroxy-3-[(2S)-2-(morpholine-4-carbonyl)pyrrolidine-1-carbonyl]heptanamide |
| SMILES | CCCC[C@@H](C(=O)N1CCC[C@H]1C(=O)N1CCOCC1)[C@H](O)C(=O)NO |
| InChI | InChI=1S/C17H29N3O6/c1-2-3-5-12(14(21)15(22)18-25)16(23)20-7-4-6-13(20)17(24)19-8-10-26-11-9-19/h12-14,21,25H,2-11H2,1H3,(H,18,22)/t12-,13+,14+/m1/s1 |
| InChIKey | VODKENRDHBOOMV-RDBSUJKOSA-N |
| XLogP | -0.49 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|