C21H36N2O5S — CID 54061465
tert-butyl (2S)-1-[6-[acetyl(methyl)amino]-2-(acetylsulfanylmethyl)hexanoyl]pyrrolidine-2-carboxylate (PubChem CID 54061465) has the molecular formula C21H36N2O5S and a molecular weight of 428.60 g/mol. Its IUPAC name is tert-butyl (2S)-1-[6-[acetyl(methyl)amino]-2-(acetylsulfanylmethyl)hexanoyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[6-[acetyl(methyl)amino]-2-(acetylsulfanylmethyl)hexanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 54061465 |
| Molecular Formula | C21H36N2O5S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | tert-butyl (2S)-1-[6-[acetyl(methyl)amino]-2-(acetylsulfanylmethyl)hexanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC(=O)SCC(CCCCN(C)C(C)=O)C(=O)N1CCC[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H36N2O5S/c1-15(24)22(6)12-8-7-10-17(14-29-16(2)25)19(26)23-13-9-11-18(23)20(27)28-21(3,4)5/h17-18H,7-14H2,1-6H3/t17?,18-/m0/s1 |
| InChIKey | MAAHHIYFROBCTM-ZVAWYAOSSA-N |
| XLogP | 2.86 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|