C15H25N3O5S — CID 18644803
(2S)-1-[(2S)-6-[acetyl(methyl)amino]-2-(nitrososulfanylmethyl)hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18644803) has the molecular formula C15H25N3O5S and a molecular weight of 359.45 g/mol. Its IUPAC name is (2S)-1-[(2S)-6-[acetyl(methyl)amino]-2-(nitrososulfanylmethyl)hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-6-[acetyl(methyl)amino]-2-(nitrososulfanylmethyl)hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18644803 |
| Molecular Formula | C15H25N3O5S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (2S)-1-[(2S)-6-[acetyl(methyl)amino]-2-(nitrososulfanylmethyl)hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(=O)N(C)CCCC[C@H](CSN=O)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C15H25N3O5S/c1-11(19)17(2)8-4-3-6-12(10-24-16-23)14(20)18-9-5-7-13(18)15(21)22/h12-13H,3-10H2,1-2H3,(H,21,22)/t12-,13+/m1/s1 |
| InChIKey | CKJBKDFNKBORKX-OLZOCXBDSA-N |
| XLogP | 1.74 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|