C12H17NO5S2 — CID 22805631
(2S)-1-[2,3-bis(acetylsulfanyl)propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 22805631) has the molecular formula C12H17NO5S2 and a molecular weight of 319.40 g/mol. Its IUPAC name is (2S)-1-[2,3-bis(acetylsulfanyl)propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2,3-bis(acetylsulfanyl)propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22805631 |
| Molecular Formula | C12H17NO5S2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | (2S)-1-[2,3-bis(acetylsulfanyl)propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(=O)SCC(SC(C)=O)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C12H17NO5S2/c1-7(14)19-6-10(20-8(2)15)11(16)13-5-3-4-9(13)12(17)18/h9-10H,3-6H2,1-2H3,(H,17,18)/t9-,10?/m0/s1 |
| InChIKey | NSXKABIPBQVCMZ-RGURZIINSA-N |
| XLogP | 0.99 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|