C8H13NO3S2 — CID 58153789
(2S)-1-[2-(disulfanyl)propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 58153789) has the molecular formula C8H13NO3S2 and a molecular weight of 235.33 g/mol. Its IUPAC name is (2S)-1-[2-(disulfanyl)propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-(disulfanyl)propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 58153789 |
| Molecular Formula | C8H13NO3S2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | (2S)-1-[2-(disulfanyl)propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(SS)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C8H13NO3S2/c1-5(14-13)7(10)9-4-2-3-6(9)8(11)12/h5-6,13H,2-4H2,1H3,(H,11,12)/t5?,6-/m0/s1 |
| InChIKey | XZGWOHDNXISVLM-GDVGLLTNSA-N |
| XLogP | 1.03 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|