C9H15NO5 — CID 56605024
1-(2,3-dihydroxybutanoyl)pyrrolidine-2-carboxylic acid (PubChem CID 56605024) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is 1-(2,3-dihydroxybutanoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 1-(2,3-dihydroxybutanoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 56605024 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 1-(2,3-dihydroxybutanoyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(O)C(O)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C9H15NO5/c1-5(11)7(12)8(13)10-4-2-3-6(10)9(14)15/h5-7,11-12H,2-4H2,1H3,(H,14,15) |
| InChIKey | IYAOVDMQZVFWFP-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |