C10H17N3O4S — CID 18644804
(2S)-1-[(2S)-4-amino-2-(nitrososulfanylmethyl)butanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18644804) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is (2S)-1-[(2S)-4-amino-2-(nitrososulfanylmethyl)butanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-4-amino-2-(nitrososulfanylmethyl)butanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18644804 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | (2S)-1-[(2S)-4-amino-2-(nitrososulfanylmethyl)butanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NCC[C@H](CSN=O)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C10H17N3O4S/c11-4-3-7(6-18-12-17)9(14)13-5-1-2-8(13)10(15)16/h7-8H,1-6,11H2,(H,15,16)/t7-,8+/m1/s1 |
| InChIKey | QHFYANZVIAPDJK-SFYZADRCSA-N |
| XLogP | 0.44 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|