C28H39Cl3N2O7 — CID 10258353
1-O-benzyl 3-O-tert-butyl (3S)-2-[(2S)-2-[2-oxo-2-(2,2,2-trichloroethoxy)ethyl]heptanoyl]diazinane-1,3-dicarboxylate (PubChem CID 10258353) has the molecular formula C28H39Cl3N2O7 and a molecular weight of 621.99 g/mol. Its IUPAC name is 1-O-benzyl 3-O-tert-butyl (3S)-2-[(2S)-2-[2-oxo-2-(2,2,2-trichloroethoxy)ethyl]heptanoyl]diazinane-1,3-dicarboxylate.
| Compound Name | 1-O-benzyl 3-O-tert-butyl (3S)-2-[(2S)-2-[2-oxo-2-(2,2,2-trichloroethoxy)ethyl]heptanoyl]diazinane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 10258353 |
| Molecular Formula | C28H39Cl3N2O7 |
| Molecular Weight | 621.99 g/mol |
| Exact Mass | 620.18 |
| IUPAC Name | 1-O-benzyl 3-O-tert-butyl (3S)-2-[(2S)-2-[2-oxo-2-(2,2,2-trichloroethoxy)ethyl]heptanoyl]diazinane-1,3-dicarboxylate |
| SMILES | CCCCC[C@@H](CC(=O)OCC(Cl)(Cl)Cl)C(=O)N1[C@H](C(=O)OC(C)(C)C)CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H39Cl3N2O7/c1-5-6-8-14-21(17-23(34)39-19-28(29,30)31)24(35)33-22(25(36)40-27(2,3)4)15-11-16-32(33)26(37)38-18-20-12-9-7-10-13-20/h7,9-10,12-13,21-22H,5-6,8,11,14-19H2,1-4H3/t21-,22-/m0/s1 |
| InChIKey | NNNXBLJDFQZQAY-VXKWHMMOSA-N |
| XLogP | 6.37 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.99 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|