C31H46Cl3N2O7+ — CID 54340179
2-O-benzyl 1-O-tert-butyl (1R)-1-[(2R)-2-[2-oxo-2-(2,2,2-trichloroethoxy)ethyl]decanoyl]piperazin-1-ium-1,2-dicarboxylate (PubChem CID 54340179) has the molecular formula C31H46Cl3N2O7+ and a molecular weight of 665.08 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl (1R)-1-[(2R)-2-[2-oxo-2-(2,2,2-trichloroethoxy)ethyl]decanoyl]piperazin-1-ium-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-tert-butyl (1R)-1-[(2R)-2-[2-oxo-2-(2,2,2-trichloroethoxy)ethyl]decanoyl]piperazin-1-ium-1,2-dicarboxylate |
|---|---|
| PubChem CID | 54340179 |
| Molecular Formula | C31H46Cl3N2O7+ |
| Molecular Weight | 665.08 g/mol |
| Exact Mass | 663.24 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl (1R)-1-[(2R)-2-[2-oxo-2-(2,2,2-trichloroethoxy)ethyl]decanoyl]piperazin-1-ium-1,2-dicarboxylate |
| SMILES | CCCCCCCC[C@H](CC(=O)OCC(Cl)(Cl)Cl)C(=O)[N@@+]1(C(=O)OC(C)(C)C)CCNCC1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H46Cl3N2O7/c1-5-6-7-8-9-13-16-24(19-26(37)42-22-31(32,33)34)27(38)36(29(40)43-30(2,3)4)18-17-35-20-25(36)28(39)41-21-23-14-11-10-12-15-23/h10-12,14-15,24-25,35H,5-9,13,16-22H2,1-4H3/q+1/t24-,25?,36-/m1/s1 |
| InChIKey | QURVAEOUTJQOOH-ACYYGYJOSA-N |
| XLogP | 6.65 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.08 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|