C26H41N3O5 — CID 56614053
tert-butyl (2S)-2-[(2R)-2-[2-oxo-2-(phenylmethoxyamino)ethyl]octanoyl]piperazine-1-carboxylate (PubChem CID 56614053) has the molecular formula C26H41N3O5 and a molecular weight of 475.63 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2R)-2-[2-oxo-2-(phenylmethoxyamino)ethyl]octanoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(2R)-2-[2-oxo-2-(phenylmethoxyamino)ethyl]octanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 56614053 |
| Molecular Formula | C26H41N3O5 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | tert-butyl (2S)-2-[(2R)-2-[2-oxo-2-(phenylmethoxyamino)ethyl]octanoyl]piperazine-1-carboxylate |
| SMILES | CCCCCC[C@H](CC(=O)NOCc1ccccc1)C(=O)[C@@H]1CNCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H41N3O5/c1-5-6-7-11-14-21(17-23(30)28-33-19-20-12-9-8-10-13-20)24(31)22-18-27-15-16-29(22)25(32)34-26(2,3)4/h8-10,12-13,21-22,27H,5-7,11,14-19H2,1-4H3,(H,28,30)/t21-,22+/m1/s1 |
| InChIKey | LRIAVUYLZHBAPW-YADHBBJMSA-N |
| XLogP | 3.99 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|