C32H52N2O7 — CID 139749763
1-O-butyl 3-O-ethyl (2S)-2-[[(2R)-2-[2-oxo-2-(phenylmethoxyamino)ethyl]undecanoyl]amino]-2-propan-2-ylpropanedioate (PubChem CID 139749763) has the molecular formula C32H52N2O7 and a molecular weight of 576.78 g/mol. Its IUPAC name is 1-O-butyl 3-O-ethyl (2S)-2-[[(2R)-2-[2-oxo-2-(phenylmethoxyamino)ethyl]undecanoyl]amino]-2-propan-2-ylpropanedioate.
| Compound Name | 1-O-butyl 3-O-ethyl (2S)-2-[[(2R)-2-[2-oxo-2-(phenylmethoxyamino)ethyl]undecanoyl]amino]-2-propan-2-ylpropanedioate |
|---|---|
| PubChem CID | 139749763 |
| Molecular Formula | C32H52N2O7 |
| Molecular Weight | 576.78 g/mol |
| Exact Mass | 576.38 |
| IUPAC Name | 1-O-butyl 3-O-ethyl (2S)-2-[[(2R)-2-[2-oxo-2-(phenylmethoxyamino)ethyl]undecanoyl]amino]-2-propan-2-ylpropanedioate |
| SMILES | CCCCCCCCC[C@H](CC(=O)NOCc1ccccc1)C(=O)N[C@@](C(=O)OCC)(C(=O)OCCCC)C(C)C |
| InChI | InChI=1S/C32H52N2O7/c1-6-9-11-12-13-14-18-21-27(23-28(35)34-41-24-26-19-16-15-17-20-26)29(36)33-32(25(4)5,30(37)39-8-3)31(38)40-22-10-7-2/h15-17,19-20,25,27H,6-14,18,21-24H2,1-5H3,(H,33,36)(H,34,35)/t27-,32+/m1/s1 |
| InChIKey | JPJPJFFSGKJIEN-ZUKKLESISA-N |
| XLogP | 5.80 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.78 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|