C36H51N3O7 — CID 10746669
1-O-benzyl 3-O-tert-butyl (3S)-2-[(2R)-2-[2-oxo-2-(phenylmethoxyamino)ethyl]decanoyl]diazinane-1,3-dicarboxylate (PubChem CID 10746669) has the molecular formula C36H51N3O7 and a molecular weight of 637.82 g/mol. Its IUPAC name is 1-O-benzyl 3-O-tert-butyl (3S)-2-[(2R)-2-[2-oxo-2-(phenylmethoxyamino)ethyl]decanoyl]diazinane-1,3-dicarboxylate.
| Compound Name | 1-O-benzyl 3-O-tert-butyl (3S)-2-[(2R)-2-[2-oxo-2-(phenylmethoxyamino)ethyl]decanoyl]diazinane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 10746669 |
| Molecular Formula | C36H51N3O7 |
| Molecular Weight | 637.82 g/mol |
| Exact Mass | 637.37 |
| IUPAC Name | 1-O-benzyl 3-O-tert-butyl (3S)-2-[(2R)-2-[2-oxo-2-(phenylmethoxyamino)ethyl]decanoyl]diazinane-1,3-dicarboxylate |
| SMILES | CCCCCCCC[C@H](CC(=O)NOCc1ccccc1)C(=O)N1[C@H](C(=O)OC(C)(C)C)CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H51N3O7/c1-5-6-7-8-9-16-22-30(25-32(40)37-45-27-29-20-14-11-15-21-29)33(41)39-31(34(42)46-36(2,3)4)23-17-24-38(39)35(43)44-26-28-18-12-10-13-19-28/h10-15,18-21,30-31H,5-9,16-17,22-27H2,1-4H3,(H,37,40)/t30-,31+/m1/s1 |
| InChIKey | BWRAQQFOYMSVLE-JSOSNVBQSA-N |
| XLogP | 6.88 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.82 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|