C34H48N3O7+ — CID 54409961
(1R)-1-[(2R)-2-[2-oxo-2-(phenylmethoxyamino)ethyl]dodecanoyl]-2-phenylmethoxycarbonylpiperazin-1-ium-1-carboxylic acid (PubChem CID 54409961) has the molecular formula C34H48N3O7+ and a molecular weight of 610.77 g/mol. Its IUPAC name is (1R)-1-[(2R)-2-[2-oxo-2-(phenylmethoxyamino)ethyl]dodecanoyl]-2-phenylmethoxycarbonylpiperazin-1-ium-1-carboxylic acid.
| Compound Name | (1R)-1-[(2R)-2-[2-oxo-2-(phenylmethoxyamino)ethyl]dodecanoyl]-2-phenylmethoxycarbonylpiperazin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 54409961 |
| Molecular Formula | C34H48N3O7+ |
| Molecular Weight | 610.77 g/mol |
| Exact Mass | 610.35 |
| IUPAC Name | (1R)-1-[(2R)-2-[2-oxo-2-(phenylmethoxyamino)ethyl]dodecanoyl]-2-phenylmethoxycarbonylpiperazin-1-ium-1-carboxylic acid |
| SMILES | CCCCCCCCCC[C@H](CC(=O)NOCc1ccccc1)C(=O)[N@@+]1(C(=O)O)CCNCC1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H47N3O7/c1-2-3-4-5-6-7-8-15-20-29(23-31(38)36-44-26-28-18-13-10-14-19-28)32(39)37(34(41)42)22-21-35-24-30(37)33(40)43-25-27-16-11-9-12-17-27/h9-14,16-19,29-30,35H,2-8,15,20-26H2,1H3,(H-,36,38,41,42)/p+1/t29-,30?,37-/m1/s1 |
| InChIKey | IVWIKBPMAJYMRL-DLWLRYIKSA-O |
| XLogP | 5.51 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.77 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|