C30H39N3O7 — CID 135705270
1-O-benzyl 3-O-methyl (3S)-2-[(2S)-2-[2-oxo-2-(phenylmethoxyamino)ethyl]heptanoyl]diazinane-1,3-dicarboxylate (PubChem CID 135705270) has the molecular formula C30H39N3O7 and a molecular weight of 553.66 g/mol. Its IUPAC name is 1-O-benzyl 3-O-methyl (3S)-2-[(2S)-2-[2-oxo-2-(phenylmethoxyamino)ethyl]heptanoyl]diazinane-1,3-dicarboxylate.
| Compound Name | 1-O-benzyl 3-O-methyl (3S)-2-[(2S)-2-[2-oxo-2-(phenylmethoxyamino)ethyl]heptanoyl]diazinane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 135705270 |
| Molecular Formula | C30H39N3O7 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | 1-O-benzyl 3-O-methyl (3S)-2-[(2S)-2-[2-oxo-2-(phenylmethoxyamino)ethyl]heptanoyl]diazinane-1,3-dicarboxylate |
| SMILES | CCCCC[C@@H](CC(=O)NOCc1ccccc1)C(=O)N1[C@H](C(=O)OC)CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H39N3O7/c1-3-4-7-17-25(20-27(34)31-40-22-24-15-10-6-11-16-24)28(35)33-26(29(36)38-2)18-12-19-32(33)30(37)39-21-23-13-8-5-9-14-23/h5-6,8-11,13-16,25-26H,3-4,7,12,17-22H2,1-2H3,(H,31,34)/t25-,26-/m0/s1 |
| InChIKey | RQAZNCBILKHTDX-UIOOFZCWSA-N |
| XLogP | 4.54 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|