C21H29BrN2O4 — CID 70459339
tert-butyl (2S)-1-[(2S)-2-[[(2R)-2-bromo-3-phenylpropanoyl]amino]propanoyl]pyrrolidine-2-carboxylate (PubChem CID 70459339) has the molecular formula C21H29BrN2O4 and a molecular weight of 453.38 g/mol. Its IUPAC name is tert-butyl (2S)-1-[(2S)-2-[[(2R)-2-bromo-3-phenylpropanoyl]amino]propanoyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[(2S)-2-[[(2R)-2-bromo-3-phenylpropanoyl]amino]propanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 70459339 |
| Molecular Formula | C21H29BrN2O4 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | tert-butyl (2S)-1-[(2S)-2-[[(2R)-2-bromo-3-phenylpropanoyl]amino]propanoyl]pyrrolidine-2-carboxylate |
| SMILES | C[C@H](NC(=O)[C@H](Br)Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H29BrN2O4/c1-14(23-18(25)16(22)13-15-9-6-5-7-10-15)19(26)24-12-8-11-17(24)20(27)28-21(2,3)4/h5-7,9-10,14,16-17H,8,11-13H2,1-4H3,(H,23,25)/t14-,16+,17-/m0/s1 |
| InChIKey | QUDOUWIRNPWBEZ-UAGQMJEPSA-N |
| XLogP | 2.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|